C21H38O3Si2 — CID 102186021
ethyl (2E)-2-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-trimethylsilylcyclohepta-2,4-dien-1-ylidene]acetate (PubChem CID 102186021) has the molecular formula C21H38O3Si2 and a molecular weight of 394.70 g/mol. Its IUPAC name is ethyl (2E)-2-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-trimethylsilylcyclohepta-2,4-dien-1-ylidene]acetate.
| Compound Name | ethyl (2E)-2-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-trimethylsilylcyclohepta-2,4-dien-1-ylidene]acetate |
|---|---|
| PubChem CID | 102186021 |
| Molecular Formula | C21H38O3Si2 |
| Molecular Weight | 394.70 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | ethyl (2E)-2-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-trimethylsilylcyclohepta-2,4-dien-1-ylidene]acetate |
| SMILES | CCOC(=O)/C=C1/C=C(CO[Si](C)(C)C(C)(C)C)C=C([Si](C)(C)C)CC1 |
| InChI | InChI=1S/C21H38O3Si2/c1-10-23-20(22)15-17-11-12-19(25(5,6)7)14-18(13-17)16-24-26(8,9)21(2,3)4/h13-15H,10-12,16H2,1-9H3/b17-15+ |
| InChIKey | ZMWUYFRXJHZIAD-BMRADRMJSA-N |
| XLogP | 6.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.70 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|