C22H34O3Si — CID 101181431
methyl (2E,4E,6E,8E,10E,12E)-15-[tert-butyl(dimethyl)silyl]oxypentadeca-2,4,6,8,10,12-hexaenoate (PubChem CID 101181431) has the molecular formula C22H34O3Si and a molecular weight of 374.60 g/mol. Its IUPAC name is methyl (2E,4E,6E,8E,10E,12E)-15-[tert-butyl(dimethyl)silyl]oxypentadeca-2,4,6,8,10,12-hexaenoate.
| Compound Name | methyl (2E,4E,6E,8E,10E,12E)-15-[tert-butyl(dimethyl)silyl]oxypentadeca-2,4,6,8,10,12-hexaenoate |
|---|---|
| PubChem CID | 101181431 |
| Molecular Formula | C22H34O3Si |
| Molecular Weight | 374.60 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | methyl (2E,4E,6E,8E,10E,12E)-15-[tert-butyl(dimethyl)silyl]oxypentadeca-2,4,6,8,10,12-hexaenoate |
| SMILES | COC(=O)/C=C/C=C/C=C/C=C/C=C/C=C/CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H34O3Si/c1-22(2,3)26(5,6)25-20-18-16-14-12-10-8-7-9-11-13-15-17-19-21(23)24-4/h7-17,19H,18,20H2,1-6H3/b8-7+,11-9+,12-10+,15-13+,16-14+,19-17+ |
| InChIKey | WNBMPWOQUCRLKR-WMNCSZHSSA-N |
| XLogP | 5.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.60 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|