C13H23FO3Si — CID 23394360
ethenyl (Z)-5-[tert-butyl(dimethyl)silyl]oxy-2-fluoropent-2-enoate (PubChem CID 23394360) has the molecular formula C13H23FO3Si and a molecular weight of 274.41 g/mol. Its IUPAC name is ethenyl (Z)-5-[tert-butyl(dimethyl)silyl]oxy-2-fluoropent-2-enoate.
| Compound Name | ethenyl (Z)-5-[tert-butyl(dimethyl)silyl]oxy-2-fluoropent-2-enoate |
|---|---|
| PubChem CID | 23394360 |
| Molecular Formula | C13H23FO3Si |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | ethenyl (Z)-5-[tert-butyl(dimethyl)silyl]oxy-2-fluoropent-2-enoate |
| SMILES | C=COC(=O)/C(F)=C/CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H23FO3Si/c1-7-16-12(15)11(14)9-8-10-17-18(5,6)13(2,3)4/h7,9H,1,8,10H2,2-6H3/b11-9- |
| InChIKey | OERIWTATXIKMFE-LUAWRHEFSA-N |
| XLogP | 3.94 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|