C20H32O3Si — CID 101181428
methyl (2E,4E,6E,8E,10E)-13-[tert-butyl(dimethyl)silyl]oxytrideca-2,4,6,8,10-pentaenoate (PubChem CID 101181428) has the molecular formula C20H32O3Si and a molecular weight of 348.56 g/mol. Its IUPAC name is methyl (2E,4E,6E,8E,10E)-13-[tert-butyl(dimethyl)silyl]oxytrideca-2,4,6,8,10-pentaenoate.
| Compound Name | methyl (2E,4E,6E,8E,10E)-13-[tert-butyl(dimethyl)silyl]oxytrideca-2,4,6,8,10-pentaenoate |
|---|---|
| PubChem CID | 101181428 |
| Molecular Formula | C20H32O3Si |
| Molecular Weight | 348.56 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | methyl (2E,4E,6E,8E,10E)-13-[tert-butyl(dimethyl)silyl]oxytrideca-2,4,6,8,10-pentaenoate |
| SMILES | COC(=O)/C=C/C=C/C=C/C=C/C=C/CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H32O3Si/c1-20(2,3)24(5,6)23-18-16-14-12-10-8-7-9-11-13-15-17-19(21)22-4/h7-15,17H,16,18H2,1-6H3/b9-7+,10-8+,13-11+,14-12+,17-15+ |
| InChIKey | BZQCPAUEVQAHOF-HGQQINKYSA-N |
| XLogP | 5.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.56 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|