C17H30O2Si2 — CID 11186348
ethyl (2E)-2-[3,5-bis(trimethylsilyl)cyclohepta-2,4-dien-1-ylidene]acetate (PubChem CID 11186348) has the molecular formula C17H30O2Si2 and a molecular weight of 322.60 g/mol. Its IUPAC name is ethyl (2E)-2-[3,5-bis(trimethylsilyl)cyclohepta-2,4-dien-1-ylidene]acetate.
| Compound Name | ethyl (2E)-2-[3,5-bis(trimethylsilyl)cyclohepta-2,4-dien-1-ylidene]acetate |
|---|---|
| PubChem CID | 11186348 |
| Molecular Formula | C17H30O2Si2 |
| Molecular Weight | 322.60 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | ethyl (2E)-2-[3,5-bis(trimethylsilyl)cyclohepta-2,4-dien-1-ylidene]acetate |
| SMILES | CCOC(=O)/C=C1/C=C([Si](C)(C)C)C=C([Si](C)(C)C)CC1 |
| InChI | InChI=1S/C17H30O2Si2/c1-8-19-17(18)12-14-9-10-15(20(2,3)4)13-16(11-14)21(5,6)7/h11-13H,8-10H2,1-7H3/b14-12+ |
| InChIKey | HQLJSQMZCXWOLP-WYMLVPIESA-N |
| XLogP | 4.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.60 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|