C23H30O2 — CID 42639984
ethyl (2E)-2-[3,5-di(cyclohexen-1-yl)cyclohepta-2,4-dien-1-ylidene]acetate (PubChem CID 42639984) has the molecular formula C23H30O2 and a molecular weight of 338.49 g/mol. Its IUPAC name is ethyl (2E)-2-[3,5-di(cyclohexen-1-yl)cyclohepta-2,4-dien-1-ylidene]acetate.
| Compound Name | ethyl (2E)-2-[3,5-di(cyclohexen-1-yl)cyclohepta-2,4-dien-1-ylidene]acetate |
|---|---|
| PubChem CID | 42639984 |
| Molecular Formula | C23H30O2 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | ethyl (2E)-2-[3,5-di(cyclohexen-1-yl)cyclohepta-2,4-dien-1-ylidene]acetate |
| SMILES | CCOC(=O)/C=C1/C=C(C2=CCCCC2)C=C(C2=CCCCC2)CC1 |
| InChI | InChI=1S/C23H30O2/c1-2-25-23(24)16-18-13-14-21(19-9-5-3-6-10-19)17-22(15-18)20-11-7-4-8-12-20/h9,11,15-17H,2-8,10,12-14H2,1H3/b18-16+ |
| InChIKey | YJYZQANTRNVFFQ-FBMGVBCBSA-N |
| XLogP | 6.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|