C20H26O6 — CID 102276324
diethyl (7E)-7-(2-ethoxy-2-oxoethylidene)-1,3,5,6-tetrahydroazulene-2,2-dicarboxylate (PubChem CID 102276324) has the molecular formula C20H26O6 and a molecular weight of 362.42 g/mol. Its IUPAC name is diethyl (7E)-7-(2-ethoxy-2-oxoethylidene)-1,3,5,6-tetrahydroazulene-2,2-dicarboxylate.
| Compound Name | diethyl (7E)-7-(2-ethoxy-2-oxoethylidene)-1,3,5,6-tetrahydroazulene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 102276324 |
| Molecular Formula | C20H26O6 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | diethyl (7E)-7-(2-ethoxy-2-oxoethylidene)-1,3,5,6-tetrahydroazulene-2,2-dicarboxylate |
| SMILES | CCOC(=O)/C=C1/C=C2CC(C(=O)OCC)(C(=O)OCC)CC2=CCC1 |
| InChI | InChI=1S/C20H26O6/c1-4-24-17(21)11-14-8-7-9-15-12-20(13-16(15)10-14,18(22)25-5-2)19(23)26-6-3/h9-11H,4-8,12-13H2,1-3H3/b14-11+ |
| InChIKey | RZDTUIMCSVTPKT-SDNWHVSQSA-N |
| XLogP | 3.03 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|