About diethyl 6-formyl-6-methyl-3,5-dihydro-1H-indene-2,2-dicarboxylate
diethyl 6-formyl-6-methyl-3,5-dihydro-1H-indene-2,2-dicarboxylate (PubChem CID 10757024) has the molecular formula C17H22O5
and a molecular weight of 306.36 g/mol. Its IUPAC name is diethyl 6-formyl-6-methyl-3,5-dihydro-1H-indene-2,2-dicarboxylate.
Molecular Properties
| Compound Name | diethyl 6-formyl-6-methyl-3,5-dihydro-1H-indene-2,2-dicarboxylate |
| PubChem CID | 10757024 |
| Molecular Formula | C17H22O5 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | diethyl 6-formyl-6-methyl-3,5-dihydro-1H-indene-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC2=CCC(C)(C=O)C=C2C1 |
| InChI | InChI=1S/C17H22O5/c1-4-21-14(19)17(15(20)22-5-2)9-12-6-7-16(3,11-18)8-13(12)10-17/h6,8,11H,4-5,7,9-10H2,1-3H3 |
| InChIKey | ZSLDKINAFSHRFS-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze diethyl 6-formyl-6-methyl-3,5-dihydro-1H-indene-2,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 6-formyl-6-methyl-3,5-dihydro-1H-indene-2,2-dicarboxylate?
The IUPAC name of diethyl 6-formyl-6-methyl-3,5-dihydro-1H-indene-2,2-dicarboxylate (CID 10757024) is diethyl 6-formyl-6-methyl-3,5-dihydro-1H-indene-2,2-dicarboxylate.
What is the SMILES notation for diethyl 6-formyl-6-methyl-3,5-dihydro-1H-indene-2,2-dicarboxylate?
The canonical SMILES for diethyl 6-formyl-6-methyl-3,5-dihydro-1H-indene-2,2-dicarboxylate is CCOC(=O)C1(C(=O)OCC)CC2=CCC(C)(C=O)C=C2C1.
What is the InChIKey of diethyl 6-formyl-6-methyl-3,5-dihydro-1H-indene-2,2-dicarboxylate?
The InChIKey is ZSLDKINAFSHRFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22O5/c1-4-21-14(19)17(15(20)22-5-2)9-12-6-7-16(3,11-18)8-13(12)10-17/h6,8,11H,4-5,7,9-10H2,1-3H3.
What are the key properties of diethyl 6-formyl-6-methyl-3,5-dihydro-1H-indene-2,2-dicarboxylate?
diethyl 6-formyl-6-methyl-3,5-dihydro-1H-indene-2,2-dicarboxylate has a molecular weight of 306.36 g/mol, XLogP of 2.35, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 6-formyl-6-methyl-3,5-dihydro-1H-indene-2,2-dicarboxylate is sourced from PubChem (CID 10757024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).