C14H20O4 — CID 101120890
diethyl 3-[(Z)-3,3,3-trideuterioprop-1-enyl]cyclopent-3-ene-1,1-dicarboxylate (PubChem CID 101120890) has the molecular formula C14H20O4 and a molecular weight of 255.33 g/mol. Its IUPAC name is diethyl 3-[(Z)-3,3,3-trideuterioprop-1-enyl]cyclopent-3-ene-1,1-dicarboxylate.
| Compound Name | diethyl 3-[(Z)-3,3,3-trideuterioprop-1-enyl]cyclopent-3-ene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 101120890 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 255.33 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | diethyl 3-[(Z)-3,3,3-trideuterioprop-1-enyl]cyclopent-3-ene-1,1-dicarboxylate |
| SMILES | [2H]C([2H])([2H])/C=C\C1=CCC(C(=O)OCC)(C(=O)OCC)C1 |
| InChI | InChI=1S/C14H20O4/c1-4-7-11-8-9-14(10-11,12(15)17-5-2)13(16)18-6-3/h4,7-8H,5-6,9-10H2,1-3H3/b7-4-/i1D3 |
| InChIKey | JCBMKXUTXRSYNG-LWKOIIBMSA-N |
| XLogP | 2.40 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.33 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|