C17H24O6 — CID 101388748
diethyl 3-[(1S,2R)-2-ethoxycarbonylcyclopropyl]cyclopent-3-ene-1,1-dicarboxylate (PubChem CID 101388748) has the molecular formula C17H24O6 and a molecular weight of 324.37 g/mol. Its IUPAC name is diethyl 3-[(1S,2R)-2-ethoxycarbonylcyclopropyl]cyclopent-3-ene-1,1-dicarboxylate.
| Compound Name | diethyl 3-[(1S,2R)-2-ethoxycarbonylcyclopropyl]cyclopent-3-ene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 101388748 |
| Molecular Formula | C17H24O6 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | diethyl 3-[(1S,2R)-2-ethoxycarbonylcyclopropyl]cyclopent-3-ene-1,1-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1C[C@@H]1C1=CCC(C(=O)OCC)(C(=O)OCC)C1 |
| InChI | InChI=1S/C17H24O6/c1-4-21-14(18)13-9-12(13)11-7-8-17(10-11,15(19)22-5-2)16(20)23-6-3/h7,12-13H,4-6,8-10H2,1-3H3/t12-,13-/m1/s1 |
| InChIKey | KXKHUBHMKDBSGE-CHWSQXEVSA-N |
| XLogP | 2.02 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|