C11H14O4 — CID 23630776
dimethyl 3-(2-deuterioethenyl)cyclopent-3-ene-1,1-dicarboxylate (PubChem CID 23630776) has the molecular formula C11H14O4 and a molecular weight of 211.24 g/mol. Its IUPAC name is dimethyl 3-(2-deuterioethenyl)cyclopent-3-ene-1,1-dicarboxylate.
| Compound Name | dimethyl 3-(2-deuterioethenyl)cyclopent-3-ene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 23630776 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | dimethyl 3-(2-deuterioethenyl)cyclopent-3-ene-1,1-dicarboxylate |
| SMILES | [2H]/C=C/C1=CCC(C(=O)OC)(C(=O)OC)C1 |
| InChI | InChI=1S/C11H14O4/c1-4-8-5-6-11(7-8,9(12)14-2)10(13)15-3/h4-5H,1,6-7H2,2-3H3/i1D/b4-1+ |
| InChIKey | PQXCWIHMZLPGAX-HUFRLMNVSA-N |
| XLogP | 1.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|