C25H26O4 — CID 177408696
ethyl (2Z)-2-[3,5-bis(4-methoxyphenyl)cyclohepta-2,4-dien-1-ylidene]acetate (PubChem CID 177408696) has the molecular formula C25H26O4 and a molecular weight of 390.48 g/mol. Its IUPAC name is ethyl (2Z)-2-[3,5-bis(4-methoxyphenyl)cyclohepta-2,4-dien-1-ylidene]acetate.
| Compound Name | ethyl (2Z)-2-[3,5-bis(4-methoxyphenyl)cyclohepta-2,4-dien-1-ylidene]acetate |
|---|---|
| PubChem CID | 177408696 |
| Molecular Formula | C25H26O4 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | ethyl (2Z)-2-[3,5-bis(4-methoxyphenyl)cyclohepta-2,4-dien-1-ylidene]acetate |
| SMILES | CCOC(=O)/C=C1\C=C(c2ccc(OC)cc2)C=C(c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C25H26O4/c1-4-29-25(26)16-18-5-6-21(19-7-11-23(27-2)12-8-19)17-22(15-18)20-9-13-24(28-3)14-10-20/h7-17H,4-6H2,1-3H3/b18-16- |
| InChIKey | SDOSUBBNLJFURW-VLGSPTGOSA-N |
| XLogP | 5.45 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|