C18H30O3Si — CID 101424838
prop-2-enyl (2E,4E,6E)-9-[tert-butyl(dimethyl)silyl]oxynona-2,4,6-trienoate (PubChem CID 101424838) has the molecular formula C18H30O3Si and a molecular weight of 322.52 g/mol. Its IUPAC name is prop-2-enyl (2E,4E,6E)-9-[tert-butyl(dimethyl)silyl]oxynona-2,4,6-trienoate.
| Compound Name | prop-2-enyl (2E,4E,6E)-9-[tert-butyl(dimethyl)silyl]oxynona-2,4,6-trienoate |
|---|---|
| PubChem CID | 101424838 |
| Molecular Formula | C18H30O3Si |
| Molecular Weight | 322.52 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | prop-2-enyl (2E,4E,6E)-9-[tert-butyl(dimethyl)silyl]oxynona-2,4,6-trienoate |
| SMILES | C=CCOC(=O)/C=C/C=C/C=C/CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H30O3Si/c1-7-15-20-17(19)14-12-10-8-9-11-13-16-21-22(5,6)18(2,3)4/h7-12,14H,1,13,15-16H2,2-6H3/b10-8+,11-9+,14-12+ |
| InChIKey | AGNFQBVXEJMBQH-YXULGHPXSA-N |
| XLogP | 4.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.52 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|