C21H34O3Si — CID 101181430
methyl (2E,4E,6E,8E,10E)-13-[tert-butyl(dimethyl)silyl]oxy-2-methyltrideca-2,4,6,8,10-pentaenoate (PubChem CID 101181430) has the molecular formula C21H34O3Si and a molecular weight of 362.59 g/mol. Its IUPAC name is methyl (2E,4E,6E,8E,10E)-13-[tert-butyl(dimethyl)silyl]oxy-2-methyltrideca-2,4,6,8,10-pentaenoate.
| Compound Name | methyl (2E,4E,6E,8E,10E)-13-[tert-butyl(dimethyl)silyl]oxy-2-methyltrideca-2,4,6,8,10-pentaenoate |
|---|---|
| PubChem CID | 101181430 |
| Molecular Formula | C21H34O3Si |
| Molecular Weight | 362.59 g/mol |
| Exact Mass | 362.23 |
| IUPAC Name | methyl (2E,4E,6E,8E,10E)-13-[tert-butyl(dimethyl)silyl]oxy-2-methyltrideca-2,4,6,8,10-pentaenoate |
| SMILES | COC(=O)/C(C)=C/C=C/C=C/C=C/C=C/CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H34O3Si/c1-19(20(22)23-5)17-15-13-11-9-8-10-12-14-16-18-24-25(6,7)21(2,3)4/h8-15,17H,16,18H2,1-7H3/b10-8+,11-9+,14-12+,15-13+,19-17+ |
| InChIKey | VKDUZXMVHROHII-SUMWQBLDSA-N |
| XLogP | 5.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.59 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|