C24H40O3Si — CID 162396993
methyl (2E,4Z,6Z,8S,9S,10E)-9-[tert-butyl(dimethyl)silyl]oxy-4,6,8,11-tetramethyltrideca-2,4,6,10,12-pentaenoate (PubChem CID 162396993) has the molecular formula C24H40O3Si and a molecular weight of 404.67 g/mol. Its IUPAC name is methyl (2E,4Z,6Z,8S,9S,10E)-9-[tert-butyl(dimethyl)silyl]oxy-4,6,8,11-tetramethyltrideca-2,4,6,10,12-pentaenoate.
| Compound Name | methyl (2E,4Z,6Z,8S,9S,10E)-9-[tert-butyl(dimethyl)silyl]oxy-4,6,8,11-tetramethyltrideca-2,4,6,10,12-pentaenoate |
|---|---|
| PubChem CID | 162396993 |
| Molecular Formula | C24H40O3Si |
| Molecular Weight | 404.67 g/mol |
| Exact Mass | 404.27 |
| IUPAC Name | methyl (2E,4Z,6Z,8S,9S,10E)-9-[tert-butyl(dimethyl)silyl]oxy-4,6,8,11-tetramethyltrideca-2,4,6,10,12-pentaenoate |
| SMILES | C=C/C(C)=C/[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)/C=C(C)\C=C(C)/C=C/C(=O)OC |
| InChI | InChI=1S/C24H40O3Si/c1-12-18(2)17-22(27-28(10,11)24(6,7)8)21(5)16-20(4)15-19(3)13-14-23(25)26-9/h12-17,21-22H,1H2,2-11H3/b14-13+,18-17+,19-15-,20-16-/t21-,22+/m0/s1 |
| InChIKey | MWKXKLANFUJJFK-MHBIXFDCSA-N |
| XLogP | 6.77 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.67 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|