C16H30O3Si — CID 138984142
ethyl (2E)-3-[tert-butyl(dimethyl)silyl]oxyocta-2,7-dienoate (PubChem CID 138984142) has the molecular formula C16H30O3Si and a molecular weight of 298.50 g/mol. Its IUPAC name is ethyl (2E)-3-[tert-butyl(dimethyl)silyl]oxyocta-2,7-dienoate.
| Compound Name | ethyl (2E)-3-[tert-butyl(dimethyl)silyl]oxyocta-2,7-dienoate |
|---|---|
| PubChem CID | 138984142 |
| Molecular Formula | C16H30O3Si |
| Molecular Weight | 298.50 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | ethyl (2E)-3-[tert-butyl(dimethyl)silyl]oxyocta-2,7-dienoate |
| SMILES | C=CCCC/C(=C\C(=O)OCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H30O3Si/c1-8-10-11-12-14(13-15(17)18-9-2)19-20(6,7)16(3,4)5/h8,13H,1,9-12H2,2-7H3/b14-13+ |
| InChIKey | MESHXTOPYWRMNM-BUHFOSPRSA-N |
| XLogP | 4.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.50 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|