C23H42O3Si — CID 86742994
[(2Z,6E)-10-[tert-butyl(dimethyl)silyl]oxy-3,7,11-trimethyldodeca-2,6,11-trienyl] acetate (PubChem CID 86742994) has the molecular formula C23H42O3Si and a molecular weight of 394.67 g/mol. Its IUPAC name is [(2Z,6E)-10-[tert-butyl(dimethyl)silyl]oxy-3,7,11-trimethyldodeca-2,6,11-trienyl] acetate.
| Compound Name | [(2Z,6E)-10-[tert-butyl(dimethyl)silyl]oxy-3,7,11-trimethyldodeca-2,6,11-trienyl] acetate |
|---|---|
| PubChem CID | 86742994 |
| Molecular Formula | C23H42O3Si |
| Molecular Weight | 394.67 g/mol |
| Exact Mass | 394.29 |
| IUPAC Name | [(2Z,6E)-10-[tert-butyl(dimethyl)silyl]oxy-3,7,11-trimethyldodeca-2,6,11-trienyl] acetate |
| SMILES | C=C(C)C(CC/C(C)=C/CC/C(C)=C\COC(C)=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H42O3Si/c1-18(2)22(26-27(9,10)23(6,7)8)15-14-19(3)12-11-13-20(4)16-17-25-21(5)24/h12,16,22H,1,11,13-15,17H2,2-10H3/b19-12+,20-16- |
| InChIKey | AWKUKUPGTIBTBT-LULTWYLNSA-N |
| XLogP | 6.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.67 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|