C18H33IO5Si — CID 46188085
[(E,4S)-4-acetyloxy-8-[tert-butyl(dimethyl)silyl]oxy-3-iodooct-2-enyl] acetate (PubChem CID 46188085) has the molecular formula C18H33IO5Si and a molecular weight of 484.45 g/mol. Its IUPAC name is [(E,4S)-4-acetyloxy-8-[tert-butyl(dimethyl)silyl]oxy-3-iodooct-2-enyl] acetate.
| Compound Name | [(E,4S)-4-acetyloxy-8-[tert-butyl(dimethyl)silyl]oxy-3-iodooct-2-enyl] acetate |
|---|---|
| PubChem CID | 46188085 |
| Molecular Formula | C18H33IO5Si |
| Molecular Weight | 484.45 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | [(E,4S)-4-acetyloxy-8-[tert-butyl(dimethyl)silyl]oxy-3-iodooct-2-enyl] acetate |
| SMILES | CC(=O)OC/C=C(/I)[C@H](CCCCO[Si](C)(C)C(C)(C)C)OC(C)=O |
| InChI | InChI=1S/C18H33IO5Si/c1-14(20)22-13-11-16(19)17(24-15(2)21)10-8-9-12-23-25(6,7)18(3,4)5/h11,17H,8-10,12-13H2,1-7H3/b16-11+/t17-/m0/s1 |
| InChIKey | WBVSJXCPAJTUKD-YTBHAWNYSA-N |
| XLogP | 4.99 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.45 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|