C17H32O5Si — CID 11405217
methyl (E,4R)-4-acetyloxy-8-[tert-butyl(dimethyl)silyl]oxyoct-2-enoate (PubChem CID 11405217) has the molecular formula C17H32O5Si and a molecular weight of 344.52 g/mol. Its IUPAC name is methyl (E,4R)-4-acetyloxy-8-[tert-butyl(dimethyl)silyl]oxyoct-2-enoate.
| Compound Name | methyl (E,4R)-4-acetyloxy-8-[tert-butyl(dimethyl)silyl]oxyoct-2-enoate |
|---|---|
| PubChem CID | 11405217 |
| Molecular Formula | C17H32O5Si |
| Molecular Weight | 344.52 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | methyl (E,4R)-4-acetyloxy-8-[tert-butyl(dimethyl)silyl]oxyoct-2-enoate |
| SMILES | COC(=O)/C=C/[C@@H](CCCCO[Si](C)(C)C(C)(C)C)OC(C)=O |
| InChI | InChI=1S/C17H32O5Si/c1-14(18)22-15(11-12-16(19)20-5)10-8-9-13-21-23(6,7)17(2,3)4/h11-12,15H,8-10,13H2,1-7H3/b12-11+/t15-/m1/s1 |
| InChIKey | QRQRMHPTEYPCTK-AYJWMTRPSA-N |
| XLogP | 3.84 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.52 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|