C24H46O5Si — CID 11123112
[(2R,6E,8E,10R,12S)-14-[tert-butyl(dimethyl)silyl]oxy-10,12-dimethoxytetradeca-6,8-dien-2-yl] acetate (PubChem CID 11123112) has the molecular formula C24H46O5Si and a molecular weight of 442.71 g/mol. Its IUPAC name is [(2R,6E,8E,10R,12S)-14-[tert-butyl(dimethyl)silyl]oxy-10,12-dimethoxytetradeca-6,8-dien-2-yl] acetate.
| Compound Name | [(2R,6E,8E,10R,12S)-14-[tert-butyl(dimethyl)silyl]oxy-10,12-dimethoxytetradeca-6,8-dien-2-yl] acetate |
|---|---|
| PubChem CID | 11123112 |
| Molecular Formula | C24H46O5Si |
| Molecular Weight | 442.71 g/mol |
| Exact Mass | 442.31 |
| IUPAC Name | [(2R,6E,8E,10R,12S)-14-[tert-butyl(dimethyl)silyl]oxy-10,12-dimethoxytetradeca-6,8-dien-2-yl] acetate |
| SMILES | CO[C@@H](CCO[Si](C)(C)C(C)(C)C)C[C@H](/C=C/C=C/CCC[C@@H](C)OC(C)=O)OC |
| InChI | InChI=1S/C24H46O5Si/c1-20(29-21(2)25)15-13-11-10-12-14-16-22(26-6)19-23(27-7)17-18-28-30(8,9)24(3,4)5/h10,12,14,16,20,22-23H,11,13,15,17-19H2,1-9H3/b12-10+,16-14+/t20-,22+,23+/m1/s1 |
| InChIKey | BDFGMNYYBKYHKO-ITHKTJFNSA-N |
| XLogP | 6.05 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.71 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|