C28H52O6Si2 — CID 138976732
(3E,7S,10E,14S)-7,14-bis[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,8-dioxacyclotetradeca-3,10-diene-2,9-dione (PubChem CID 138976732) has the molecular formula C28H52O6Si2 and a molecular weight of 540.89 g/mol. Its IUPAC name is (3E,7S,10E,14S)-7,14-bis[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,8-dioxacyclotetradeca-3,10-diene-2,9-dione.
| Compound Name | (3E,7S,10E,14S)-7,14-bis[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,8-dioxacyclotetradeca-3,10-diene-2,9-dione |
|---|---|
| PubChem CID | 138976732 |
| Molecular Formula | C28H52O6Si2 |
| Molecular Weight | 540.89 g/mol |
| Exact Mass | 540.33 |
| IUPAC Name | (3E,7S,10E,14S)-7,14-bis[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,8-dioxacyclotetradeca-3,10-diene-2,9-dione |
| SMILES | CC(C)(C)[Si](C)(C)OCC[C@@H]1CC/C=C/C(=O)O[C@H](CCO[Si](C)(C)C(C)(C)C)CC/C=C/C(=O)O1 |
| InChI | InChI=1S/C28H52O6Si2/c1-27(2,3)35(7,8)31-21-19-23-15-11-13-18-26(30)34-24(16-12-14-17-25(29)33-23)20-22-32-36(9,10)28(4,5)6/h13-14,17-18,23-24H,11-12,15-16,19-22H2,1-10H3/b17-14+,18-13+/t23-,24-/m0/s1 |
| InChIKey | RTTBWMUQOJVHMJ-ZHGQLLPWSA-N |
| XLogP | 7.32 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.89 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|