C25H40O5Si — CID 11282328
[(2E,5E)-3-acetyloxy-2-[2-[tert-butyl(dimethyl)silyl]oxyethylidene]-6,10-dimethylundeca-5,9-dien-7-ynyl] acetate (PubChem CID 11282328) has the molecular formula C25H40O5Si and a molecular weight of 448.68 g/mol. Its IUPAC name is [(2E,5E)-3-acetyloxy-2-[2-[tert-butyl(dimethyl)silyl]oxyethylidene]-6,10-dimethylundeca-5,9-dien-7-ynyl] acetate.
| Compound Name | [(2E,5E)-3-acetyloxy-2-[2-[tert-butyl(dimethyl)silyl]oxyethylidene]-6,10-dimethylundeca-5,9-dien-7-ynyl] acetate |
|---|---|
| PubChem CID | 11282328 |
| Molecular Formula | C25H40O5Si |
| Molecular Weight | 448.68 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | [(2E,5E)-3-acetyloxy-2-[2-[tert-butyl(dimethyl)silyl]oxyethylidene]-6,10-dimethylundeca-5,9-dien-7-ynyl] acetate |
| SMILES | CC(=O)OC/C(=C\CO[Si](C)(C)C(C)(C)C)C(C/C=C(\C)C#CC=C(C)C)OC(C)=O |
| InChI | InChI=1S/C25H40O5Si/c1-19(2)12-11-13-20(3)14-15-24(30-22(5)27)23(18-28-21(4)26)16-17-29-31(9,10)25(6,7)8/h12,14,16,24H,15,17-18H2,1-10H3/b20-14+,23-16+ |
| InChIKey | QCYGLLIHTAQCMO-JOJMNHRDSA-N |
| XLogP | 5.74 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.68 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|