C37H68Cl2O8Si — CID 162186178
[(Z,10S)-11-[tert-butyl(dimethyl)silyl]oxy-6,10-dimethyl-2-oxoundec-5-en-3-yl] acetate;dichloromethane;[(Z,10S)-11-hydroxy-6,10-dimethyl-2-oxoundec-5-en-3-yl] acetate (PubChem CID 162186178) has the molecular formula C37H68Cl2O8Si and a molecular weight of 739.93 g/mol. Its IUPAC name is [(Z,10S)-11-[tert-butyl(dimethyl)silyl]oxy-6,10-dimethyl-2-oxoundec-5-en-3-yl] acetate;dichloromethane;[(Z,10S)-11-hydroxy-6,10-dimethyl-2-oxoundec-5-en-3-yl] acetate.
| Compound Name | [(Z,10S)-11-[tert-butyl(dimethyl)silyl]oxy-6,10-dimethyl-2-oxoundec-5-en-3-yl] acetate;dichloromethane;[(Z,10S)-11-hydroxy-6,10-dimethyl-2-oxoundec-5-en-3-yl] acetate |
|---|---|
| PubChem CID | 162186178 |
| Molecular Formula | C37H68Cl2O8Si |
| Molecular Weight | 739.93 g/mol |
| Exact Mass | 738.41 |
| IUPAC Name | [(Z,10S)-11-[tert-butyl(dimethyl)silyl]oxy-6,10-dimethyl-2-oxoundec-5-en-3-yl] acetate;dichloromethane;[(Z,10S)-11-hydroxy-6,10-dimethyl-2-oxoundec-5-en-3-yl] acetate |
| SMILES | CC(=O)OC(C/C=C(/C)CCC[C@H](C)CO)C(C)=O.CC(=O)OC(C/C=C(/C)CCC[C@H](C)CO[Si](C)(C)C(C)(C)C)C(C)=O.ClCCl |
| InChI | InChI=1S/C21H40O4Si.C15H26O4.CH2Cl2/c1-16(13-14-20(18(3)22)25-19(4)23)11-10-12-17(2)15-24-26(8,9)21(5,6)7;1-11(6-5-7-12(2)10-16)8-9-15(13(3)17)19-14(4)18;2-1-3/h13,17,20H,10-12,14-15H2,1-9H3;8,12,15-16H,5-7,9-10H2,1-4H3;1H2/b16-13-;11-8-;/t17-,20?;12-,15?;/m00./s1 |
| InChIKey | ZPRJJSBERXPOAV-BENHWFNPSA-N |
| XLogP | 9.74 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.93 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|