C21H40O4Si — CID 173120026
[(10S)-1-dimethylsilyloxy-6,10,12,12-tetramethyl-2-oxotridec-5-en-3-yl] acetate (PubChem CID 173120026) has the molecular formula C21H40O4Si and a molecular weight of 384.63 g/mol. Its IUPAC name is [(10S)-1-dimethylsilyloxy-6,10,12,12-tetramethyl-2-oxotridec-5-en-3-yl] acetate.
| Compound Name | [(10S)-1-dimethylsilyloxy-6,10,12,12-tetramethyl-2-oxotridec-5-en-3-yl] acetate |
|---|---|
| PubChem CID | 173120026 |
| Molecular Formula | C21H40O4Si |
| Molecular Weight | 384.63 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | [(10S)-1-dimethylsilyloxy-6,10,12,12-tetramethyl-2-oxotridec-5-en-3-yl] acetate |
| SMILES | CC(=O)OC(CC=C(C)CCC[C@H](C)CC(C)(C)C)C(=O)CO[SiH](C)C |
| InChI | InChI=1S/C21H40O4Si/c1-16(10-9-11-17(2)14-21(4,5)6)12-13-20(25-18(3)22)19(23)15-24-26(7)8/h12,17,20,26H,9-11,13-15H2,1-8H3/t17-,20?/m0/s1 |
| InChIKey | PDDCUJLZDQVYGC-DIMJTDRSSA-N |
| XLogP | 5.07 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.63 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|