C39H54O6 — CID 85324381
[4-acetyloxy-3-(acetyloxymethylidene)-7,11-dimethyldodeca-6,10-dien-8-ynyl] icosa-5,8,11,14,17-pentaenoate (PubChem CID 85324381) has the molecular formula C39H54O6 and a molecular weight of 618.86 g/mol. Its IUPAC name is [4-acetyloxy-3-(acetyloxymethylidene)-7,11-dimethyldodeca-6,10-dien-8-ynyl] icosa-5,8,11,14,17-pentaenoate.
| Compound Name | [4-acetyloxy-3-(acetyloxymethylidene)-7,11-dimethyldodeca-6,10-dien-8-ynyl] icosa-5,8,11,14,17-pentaenoate |
|---|---|
| PubChem CID | 85324381 |
| Molecular Formula | C39H54O6 |
| Molecular Weight | 618.86 g/mol |
| Exact Mass | 618.39 |
| IUPAC Name | [4-acetyloxy-3-(acetyloxymethylidene)-7,11-dimethyldodeca-6,10-dien-8-ynyl] icosa-5,8,11,14,17-pentaenoate |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCCC(=COC(C)=O)C(CC=C(C)C#CC=C(C)C)OC(C)=O |
| InChI | InChI=1S/C39H54O6/c1-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-27-39(42)43-31-30-37(32-44-35(5)40)38(45-36(6)41)29-28-34(4)26-24-25-33(2)3/h8-9,11-12,14-15,17-18,20-21,25,28,32,38H,7,10,13,16,19,22-23,27,29-31H2,1-6H3 |
| InChIKey | TWRGQYZSZNPUEM-UHFFFAOYSA-N |
| XLogP | 9.53 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.86 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|