C34H48O6 — CID 171119685
[(3Z,6E)-4-acetyloxy-3-(acetyloxymethylidene)-7,11-dimethyldodeca-6,10-dien-8-ynyl] (6E,9E,12E)-pentadeca-6,9,12-trienoate (PubChem CID 171119685) has the molecular formula C34H48O6 and a molecular weight of 552.75 g/mol. Its IUPAC name is [(3Z,6E)-4-acetyloxy-3-(acetyloxymethylidene)-7,11-dimethyldodeca-6,10-dien-8-ynyl] (6E,9E,12E)-pentadeca-6,9,12-trienoate.
| Compound Name | [(3Z,6E)-4-acetyloxy-3-(acetyloxymethylidene)-7,11-dimethyldodeca-6,10-dien-8-ynyl] (6E,9E,12E)-pentadeca-6,9,12-trienoate |
|---|---|
| PubChem CID | 171119685 |
| Molecular Formula | C34H48O6 |
| Molecular Weight | 552.75 g/mol |
| Exact Mass | 552.35 |
| IUPAC Name | [(3Z,6E)-4-acetyloxy-3-(acetyloxymethylidene)-7,11-dimethyldodeca-6,10-dien-8-ynyl] (6E,9E,12E)-pentadeca-6,9,12-trienoate |
| SMILES | CC/C=C/C/C=C/C/C=C/CCCCC(=O)OCC/C(=C/OC(C)=O)C(C/C=C(\C)C#CC=C(C)C)OC(C)=O |
| InChI | InChI=1S/C34H48O6/c1-7-8-9-10-11-12-13-14-15-16-17-18-22-34(37)38-26-25-32(27-39-30(5)35)33(40-31(6)36)24-23-29(4)21-19-20-28(2)3/h8-9,11-12,14-15,20,23,27,33H,7,10,13,16-18,22,24-26H2,1-6H3/b9-8+,12-11+,15-14+,29-23+,32-27- |
| InChIKey | IEUQOOCFNPBHKO-UVOOFOQQSA-N |
| XLogP | 8.02 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.75 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|