C15H26O3Si — CID 10924033
(E,7S)-7-[tert-butyl(dimethyl)silyl]oxy-5-methyloct-4-en-2-ynoic acid (PubChem CID 10924033) has the molecular formula C15H26O3Si and a molecular weight of 282.46 g/mol. Its IUPAC name is (E,7S)-7-[tert-butyl(dimethyl)silyl]oxy-5-methyloct-4-en-2-ynoic acid.
| Compound Name | (E,7S)-7-[tert-butyl(dimethyl)silyl]oxy-5-methyloct-4-en-2-ynoic acid |
|---|---|
| PubChem CID | 10924033 |
| Molecular Formula | C15H26O3Si |
| Molecular Weight | 282.46 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | (E,7S)-7-[tert-butyl(dimethyl)silyl]oxy-5-methyloct-4-en-2-ynoic acid |
| SMILES | C/C(=C\C#CC(=O)O)C[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H26O3Si/c1-12(9-8-10-14(16)17)11-13(2)18-19(6,7)15(3,4)5/h9,13H,11H2,1-7H3,(H,16,17)/b12-9+/t13-/m0/s1 |
| InChIKey | HVHMRMGSFBRSAP-SRXBQZRASA-N |
| XLogP | 3.82 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.46 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|