C15H27IO3Si — CID 135076905
[1-[tert-butyl(dimethyl)silyl]oxy-4-methylpent-4-en-2-yl] (E)-3-iodoprop-2-enoate (PubChem CID 135076905) has the molecular formula C15H27IO3Si and a molecular weight of 410.37 g/mol. Its IUPAC name is [1-[tert-butyl(dimethyl)silyl]oxy-4-methylpent-4-en-2-yl] (E)-3-iodoprop-2-enoate.
| Compound Name | [1-[tert-butyl(dimethyl)silyl]oxy-4-methylpent-4-en-2-yl] (E)-3-iodoprop-2-enoate |
|---|---|
| PubChem CID | 135076905 |
| Molecular Formula | C15H27IO3Si |
| Molecular Weight | 410.37 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | [1-[tert-butyl(dimethyl)silyl]oxy-4-methylpent-4-en-2-yl] (E)-3-iodoprop-2-enoate |
| SMILES | C=C(C)CC(CO[Si](C)(C)C(C)(C)C)OC(=O)/C=C/I |
| InChI | InChI=1S/C15H27IO3Si/c1-12(2)10-13(19-14(17)8-9-16)11-18-20(6,7)15(3,4)5/h8-9,13H,1,10-11H2,2-7H3/b9-8+ |
| InChIKey | GSUXXKXKVKNWFU-CMDGGOBGSA-N |
| XLogP | 4.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.37 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|