C13H24O3Si — CID 20631232
2-[dimethyl(4-methylpent-4-enyl)silyl]oxyethyl prop-2-enoate (PubChem CID 20631232) has the molecular formula C13H24O3Si and a molecular weight of 256.42 g/mol. Its IUPAC name is 2-[dimethyl(4-methylpent-4-enyl)silyl]oxyethyl prop-2-enoate.
| Compound Name | 2-[dimethyl(4-methylpent-4-enyl)silyl]oxyethyl prop-2-enoate |
|---|---|
| PubChem CID | 20631232 |
| Molecular Formula | C13H24O3Si |
| Molecular Weight | 256.42 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 2-[dimethyl(4-methylpent-4-enyl)silyl]oxyethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCO[Si](C)(C)CCCC(=C)C |
| InChI | InChI=1S/C13H24O3Si/c1-6-13(14)15-9-10-16-17(4,5)11-7-8-12(2)3/h6H,1-2,7-11H2,3-5H3 |
| InChIKey | KTQWHJCWOWNROB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.42 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|