C30H56O14Si5 — CID 155602776
2-[[[[dimethyl-[[methyl-bis(2-prop-2-enoyloxyethoxy)silyl]methyl]silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]methyl-methyl-(2-prop-2-enoyloxyethoxy)silyl]oxyethyl prop-2-enoate (PubChem CID 155602776) has the molecular formula C30H56O14Si5 and a molecular weight of 781.19 g/mol. Its IUPAC name is 2-[[[[dimethyl-[[methyl-bis(2-prop-2-enoyloxyethoxy)silyl]methyl]silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]methyl-methyl-(2-prop-2-enoyloxyethoxy)silyl]oxyethyl prop-2-enoate.
| Compound Name | 2-[[[[dimethyl-[[methyl-bis(2-prop-2-enoyloxyethoxy)silyl]methyl]silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]methyl-methyl-(2-prop-2-enoyloxyethoxy)silyl]oxyethyl prop-2-enoate |
|---|---|
| PubChem CID | 155602776 |
| Molecular Formula | C30H56O14Si5 |
| Molecular Weight | 781.19 g/mol |
| Exact Mass | 780.25 |
| IUPAC Name | 2-[[[[dimethyl-[[methyl-bis(2-prop-2-enoyloxyethoxy)silyl]methyl]silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]methyl-methyl-(2-prop-2-enoyloxyethoxy)silyl]oxyethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCO[Si](C)(C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C[Si](C)(OCCOC(=O)C=C)OCCOC(=O)C=C)OCCOC(=O)C=C |
| InChI | InChI=1S/C30H56O14Si5/c1-13-27(31)35-17-21-39-48(11,40-22-18-36-28(32)14-2)25-45(5,6)43-47(9,10)44-46(7,8)26-49(12,41-23-19-37-29(33)15-3)42-24-20-38-30(34)16-4/h13-16H,1-4,17-26H2,5-12H3 |
| InChIKey | HKRSEVSIOLVTCG-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 160.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.19 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|