C30H58O11Si4 — CID 156628804
2-[2-[[dimethyl-[2-[methyl-(2-prop-2-enoxyethoxy)-(2-prop-2-enoyloxyethoxy)silyl]ethyl]silyl]oxy-dimethylsilyl]ethyl-methyl-(2-prop-2-enoxyethoxy)silyl]oxyethyl prop-2-enoate (PubChem CID 156628804) has the molecular formula C30H58O11Si4 and a molecular weight of 707.13 g/mol. Its IUPAC name is 2-[2-[[dimethyl-[2-[methyl-(2-prop-2-enoxyethoxy)-(2-prop-2-enoyloxyethoxy)silyl]ethyl]silyl]oxy-dimethylsilyl]ethyl-methyl-(2-prop-2-enoxyethoxy)silyl]oxyethyl prop-2-enoate.
| Compound Name | 2-[2-[[dimethyl-[2-[methyl-(2-prop-2-enoxyethoxy)-(2-prop-2-enoyloxyethoxy)silyl]ethyl]silyl]oxy-dimethylsilyl]ethyl-methyl-(2-prop-2-enoxyethoxy)silyl]oxyethyl prop-2-enoate |
|---|---|
| PubChem CID | 156628804 |
| Molecular Formula | C30H58O11Si4 |
| Molecular Weight | 707.13 g/mol |
| Exact Mass | 706.31 |
| IUPAC Name | 2-[2-[[dimethyl-[2-[methyl-(2-prop-2-enoxyethoxy)-(2-prop-2-enoyloxyethoxy)silyl]ethyl]silyl]oxy-dimethylsilyl]ethyl-methyl-(2-prop-2-enoxyethoxy)silyl]oxyethyl prop-2-enoate |
| SMILES | C=CCOCCO[Si](C)(CC[Si](C)(C)O[Si](C)(C)CC[Si](C)(OCCOCC=C)OCCOC(=O)C=C)OCCOC(=O)C=C |
| InChI | InChI=1S/C30H58O11Si4/c1-11-15-33-17-21-37-44(9,39-23-19-35-29(31)13-3)27-25-42(5,6)41-43(7,8)26-28-45(10,38-22-18-34-16-12-2)40-24-20-36-30(32)14-4/h11-14H,1-4,15-28H2,5-10H3 |
| InChIKey | VWCZANSNQRFXTL-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 117.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.13 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|