C15H34O5Si3 — CID 88685432
2-[1-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]propoxy]ethyl prop-2-enoate (PubChem CID 88685432) has the molecular formula C15H34O5Si3 and a molecular weight of 378.69 g/mol. Its IUPAC name is 2-[1-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]propoxy]ethyl prop-2-enoate.
| Compound Name | 2-[1-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]propoxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 88685432 |
| Molecular Formula | C15H34O5Si3 |
| Molecular Weight | 378.69 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 2-[1-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]propoxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOC(CC)[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C15H34O5Si3/c1-10-14(16)17-12-13-18-15(11-2)22(6,7)20-23(8,9)19-21(3,4)5/h10,15H,1,11-13H2,2-9H3 |
| InChIKey | IZARZSRERYPXEQ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.69 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|