C14H26O3Si — CID 11129394
[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxypent-4-en-2-yl] prop-2-enoate (PubChem CID 11129394) has the molecular formula C14H26O3Si and a molecular weight of 270.44 g/mol. Its IUPAC name is [(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxypent-4-en-2-yl] prop-2-enoate.
| Compound Name | [(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxypent-4-en-2-yl] prop-2-enoate |
|---|---|
| PubChem CID | 11129394 |
| Molecular Formula | C14H26O3Si |
| Molecular Weight | 270.44 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | [(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxypent-4-en-2-yl] prop-2-enoate |
| SMILES | C=CC(=O)O[C@H](C)[C@H](C=C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H26O3Si/c1-9-12(11(3)16-13(15)10-2)17-18(7,8)14(4,5)6/h9-12H,1-2H2,3-8H3/t11-,12+/m1/s1 |
| InChIKey | JSKPYWPDWCDNBI-NEPJUHHUSA-N |
| XLogP | 3.68 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.44 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|