C13H22O3Si — CID 100929418
(2S,3S)-2-[(E)-prop-1-enyl]-3-(2-trimethylsilylethoxy)-2,3-dihydropyran-6-one (PubChem CID 100929418) has the molecular formula C13H22O3Si and a molecular weight of 254.40 g/mol. Its IUPAC name is (2S,3S)-2-[(E)-prop-1-enyl]-3-(2-trimethylsilylethoxy)-2,3-dihydropyran-6-one.
| Compound Name | (2S,3S)-2-[(E)-prop-1-enyl]-3-(2-trimethylsilylethoxy)-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 100929418 |
| Molecular Formula | C13H22O3Si |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | (2S,3S)-2-[(E)-prop-1-enyl]-3-(2-trimethylsilylethoxy)-2,3-dihydropyran-6-one |
| SMILES | C/C=C/[C@@H]1OC(=O)C=C[C@@H]1OCC[Si](C)(C)C |
| InChI | InChI=1S/C13H22O3Si/c1-5-6-12-11(7-8-13(14)16-12)15-9-10-17(2,3)4/h5-8,11-12H,9-10H2,1-4H3/b6-5+/t11-,12-/m0/s1 |
| InChIKey | DZHANXLLSYNSAR-WTIVYXKASA-N |
| XLogP | 2.77 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|