C14H25IO3Si — CID 173125119
methyl 2-(iodomethylidene)-4-methyl-3-triethylsilyloxypent-4-enoate (PubChem CID 173125119) has the molecular formula C14H25IO3Si and a molecular weight of 396.34 g/mol. Its IUPAC name is methyl 2-(iodomethylidene)-4-methyl-3-triethylsilyloxypent-4-enoate.
| Compound Name | methyl 2-(iodomethylidene)-4-methyl-3-triethylsilyloxypent-4-enoate |
|---|---|
| PubChem CID | 173125119 |
| Molecular Formula | C14H25IO3Si |
| Molecular Weight | 396.34 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | methyl 2-(iodomethylidene)-4-methyl-3-triethylsilyloxypent-4-enoate |
| SMILES | C=C(C)C(O[Si](CC)(CC)CC)C(=CI)C(=O)OC |
| InChI | InChI=1S/C14H25IO3Si/c1-7-19(8-2,9-3)18-13(11(4)5)12(10-15)14(16)17-6/h10,13H,4,7-9H2,1-3,5-6H3 |
| InChIKey | JDKYQAXRSAGUJD-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.34 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|