C13H26O3Si — CID 11108029
ethyl (3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylidenebutanoate (PubChem CID 11108029) has the molecular formula C13H26O3Si and a molecular weight of 258.43 g/mol. Its IUPAC name is ethyl (3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylidenebutanoate.
| Compound Name | ethyl (3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylidenebutanoate |
|---|---|
| PubChem CID | 11108029 |
| Molecular Formula | C13H26O3Si |
| Molecular Weight | 258.43 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | ethyl (3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylidenebutanoate |
| SMILES | C=C(C(=O)OCC)[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H26O3Si/c1-9-15-12(14)10(2)11(3)16-17(7,8)13(4,5)6/h11H,2,9H2,1,3-8H3/t11-/m1/s1 |
| InChIKey | HOGRMFQAWDEVQW-LLVKDONJSA-N |
| XLogP | 3.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|