C13H21IO3Si — CID 46939261
2-(2,2-dimethyl-5,6-dihydrooxasilin-6-yl)ethyl (Z)-5-iodopent-4-enoate (PubChem CID 46939261) has the molecular formula C13H21IO3Si and a molecular weight of 380.30 g/mol. Its IUPAC name is 2-(2,2-dimethyl-5,6-dihydrooxasilin-6-yl)ethyl (Z)-5-iodopent-4-enoate.
| Compound Name | 2-(2,2-dimethyl-5,6-dihydrooxasilin-6-yl)ethyl (Z)-5-iodopent-4-enoate |
|---|---|
| PubChem CID | 46939261 |
| Molecular Formula | C13H21IO3Si |
| Molecular Weight | 380.30 g/mol |
| Exact Mass | 380.03 |
| IUPAC Name | 2-(2,2-dimethyl-5,6-dihydrooxasilin-6-yl)ethyl (Z)-5-iodopent-4-enoate |
| SMILES | C[Si]1(C)C=CCC(CCOC(=O)CC/C=C\I)O1 |
| InChI | InChI=1S/C13H21IO3Si/c1-18(2)11-5-6-12(17-18)8-10-16-13(15)7-3-4-9-14/h4-5,9,11-12H,3,6-8,10H2,1-2H3/b9-4- |
| InChIKey | RMCWMLBSGBFNMZ-WTKPLQERSA-N |
| XLogP | 3.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.30 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|