C22H43IO5Si2 — CID 10674584
[(2R)-1-oxopropan-2-yl] (E,4S,5R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-7-iodohept-6-enoate (PubChem CID 10674584) has the molecular formula C22H43IO5Si2 and a molecular weight of 570.66 g/mol. Its IUPAC name is [(2R)-1-oxopropan-2-yl] (E,4S,5R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-7-iodohept-6-enoate.
| Compound Name | [(2R)-1-oxopropan-2-yl] (E,4S,5R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-7-iodohept-6-enoate |
|---|---|
| PubChem CID | 10674584 |
| Molecular Formula | C22H43IO5Si2 |
| Molecular Weight | 570.66 g/mol |
| Exact Mass | 570.17 |
| IUPAC Name | [(2R)-1-oxopropan-2-yl] (E,4S,5R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-7-iodohept-6-enoate |
| SMILES | C[C@H](C=O)OC(=O)CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](/C=C/I)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H43IO5Si2/c1-17(16-24)26-20(25)13-12-18(27-29(8,9)21(2,3)4)19(14-15-23)28-30(10,11)22(5,6)7/h14-19H,12-13H2,1-11H3/b15-14+/t17-,18+,19-/m1/s1 |
| InChIKey | VVFURSCCUXMATF-LYUXXCLZSA-N |
| XLogP | 6.63 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.66 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|