C21H43IO4Si2 — CID 173013267
methyl 5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-8-iodooct-7-enoate (PubChem CID 173013267) has the molecular formula C21H43IO4Si2 and a molecular weight of 542.65 g/mol. Its IUPAC name is methyl 5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-8-iodooct-7-enoate.
| Compound Name | methyl 5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-8-iodooct-7-enoate |
|---|---|
| PubChem CID | 173013267 |
| Molecular Formula | C21H43IO4Si2 |
| Molecular Weight | 542.65 g/mol |
| Exact Mass | 542.17 |
| IUPAC Name | methyl 5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-8-iodooct-7-enoate |
| SMILES | COC(=O)CCCC(O[Si](C)(C)C(C)(C)C)C(C=CI)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H43IO4Si2/c1-20(2,3)27(8,9)25-17(13-12-14-19(23)24-7)18(15-16-22)26-28(10,11)21(4,5)6/h15-18H,12-14H2,1-11H3 |
| InChIKey | CGISSXYNWYYEBI-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.65 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|