C23H46O5Si2 — CID 11167044
(4R,6S)-6-[(E,4S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylpent-1-enyl]-4-hydroxyoxan-2-one (PubChem CID 11167044) has the molecular formula C23H46O5Si2 and a molecular weight of 458.79 g/mol. Its IUPAC name is (4R,6S)-6-[(E,4S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylpent-1-enyl]-4-hydroxyoxan-2-one.
| Compound Name | (4R,6S)-6-[(E,4S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylpent-1-enyl]-4-hydroxyoxan-2-one |
|---|---|
| PubChem CID | 11167044 |
| Molecular Formula | C23H46O5Si2 |
| Molecular Weight | 458.79 g/mol |
| Exact Mass | 458.29 |
| IUPAC Name | (4R,6S)-6-[(E,4S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylpent-1-enyl]-4-hydroxyoxan-2-one |
| SMILES | C/C(=C\[C@@H]1C[C@@H](O)CC(=O)O1)C[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H46O5Si2/c1-17(12-19-14-18(24)15-21(25)27-19)13-20(28-30(10,11)23(5,6)7)16-26-29(8,9)22(2,3)4/h12,18-20,24H,13-16H2,1-11H3/b17-12+/t18-,19-,20+/m1/s1 |
| InChIKey | CYVBULVRCCOSFT-PKFQQNCQSA-N |
| XLogP | 5.80 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.79 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|