C22H42O4Si — CID 11846597
(4R,6R)-4-methoxy-6-[(Z,4R)-4-[tri(propan-2-yl)silyloxymethyl]hex-2-en-2-yl]oxan-2-one (PubChem CID 11846597) has the molecular formula C22H42O4Si and a molecular weight of 398.66 g/mol. Its IUPAC name is (4R,6R)-4-methoxy-6-[(Z,4R)-4-[tri(propan-2-yl)silyloxymethyl]hex-2-en-2-yl]oxan-2-one.
| Compound Name | (4R,6R)-4-methoxy-6-[(Z,4R)-4-[tri(propan-2-yl)silyloxymethyl]hex-2-en-2-yl]oxan-2-one |
|---|---|
| PubChem CID | 11846597 |
| Molecular Formula | C22H42O4Si |
| Molecular Weight | 398.66 g/mol |
| Exact Mass | 398.29 |
| IUPAC Name | (4R,6R)-4-methoxy-6-[(Z,4R)-4-[tri(propan-2-yl)silyloxymethyl]hex-2-en-2-yl]oxan-2-one |
| SMILES | CC[C@H](/C=C(/C)[C@H]1C[C@@H](OC)CC(=O)O1)CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C22H42O4Si/c1-10-19(14-25-27(15(2)3,16(4)5)17(6)7)11-18(8)21-12-20(24-9)13-22(23)26-21/h11,15-17,19-21H,10,12-14H2,1-9H3/b18-11-/t19-,20-,21-/m1/s1 |
| InChIKey | UQDVYESRIJGYGP-SHFOFRQLSA-N |
| XLogP | 5.87 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.66 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|