C20H38O4Si — CID 134939871
1-[(4S,6R)-6-[(E,3S,4S)-3,5-dimethyl-4-trimethylsilyloxyhex-1-enyl]-2,2-dimethyl-1,3-dioxan-4-yl]propan-2-one (PubChem CID 134939871) has the molecular formula C20H38O4Si and a molecular weight of 370.61 g/mol. Its IUPAC name is 1-[(4S,6R)-6-[(E,3S,4S)-3,5-dimethyl-4-trimethylsilyloxyhex-1-enyl]-2,2-dimethyl-1,3-dioxan-4-yl]propan-2-one.
| Compound Name | 1-[(4S,6R)-6-[(E,3S,4S)-3,5-dimethyl-4-trimethylsilyloxyhex-1-enyl]-2,2-dimethyl-1,3-dioxan-4-yl]propan-2-one |
|---|---|
| PubChem CID | 134939871 |
| Molecular Formula | C20H38O4Si |
| Molecular Weight | 370.61 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | 1-[(4S,6R)-6-[(E,3S,4S)-3,5-dimethyl-4-trimethylsilyloxyhex-1-enyl]-2,2-dimethyl-1,3-dioxan-4-yl]propan-2-one |
| SMILES | CC(=O)C[C@@H]1C[C@H](/C=C/[C@H](C)[C@@H](O[Si](C)(C)C)C(C)C)OC(C)(C)O1 |
| InChI | InChI=1S/C20H38O4Si/c1-14(2)19(24-25(7,8)9)15(3)10-11-17-13-18(12-16(4)21)23-20(5,6)22-17/h10-11,14-15,17-19H,12-13H2,1-9H3/b11-10+/t15-,17-,18+,19-/m0/s1 |
| InChIKey | YWBDLYGNFJRTGD-VNNJKJODSA-N |
| XLogP | 4.94 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.61 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|