C32H56O6Si — CID 24885705
ethyl (2E,4E,6S)-6-[(4S,5R,6R)-6-[(Z,2S,6S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-6-ethyl-3-oxooct-4-en-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]hepta-2,4-dienoate (PubChem CID 24885705) has the molecular formula C32H56O6Si and a molecular weight of 564.88 g/mol. Its IUPAC name is ethyl (2E,4E,6S)-6-[(4S,5R,6R)-6-[(Z,2S,6S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-6-ethyl-3-oxooct-4-en-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]hepta-2,4-dienoate.
| Compound Name | ethyl (2E,4E,6S)-6-[(4S,5R,6R)-6-[(Z,2S,6S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-6-ethyl-3-oxooct-4-en-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]hepta-2,4-dienoate |
|---|---|
| PubChem CID | 24885705 |
| Molecular Formula | C32H56O6Si |
| Molecular Weight | 564.88 g/mol |
| Exact Mass | 564.38 |
| IUPAC Name | ethyl (2E,4E,6S)-6-[(4S,5R,6R)-6-[(Z,2S,6S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-6-ethyl-3-oxooct-4-en-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]hepta-2,4-dienoate |
| SMILES | CCOC(=O)/C=C/C=C/[C@H](C)[C@@H]1OC(C)(C)O[C@@H]([C@H](C)C(=O)/C=C\[C@H](CC)[C@@H](C)O[Si](C)(C)C(C)(C)C)[C@@H]1C |
| InChI | InChI=1S/C32H56O6Si/c1-14-26(25(6)38-39(12,13)31(7,8)9)20-21-27(33)23(4)30-24(5)29(36-32(10,11)37-30)22(3)18-16-17-19-28(34)35-15-2/h16-26,29-30H,14-15H2,1-13H3/b18-16+,19-17+,21-20-/t22-,23+,24+,25+,26-,29-,30-/m0/s1 |
| InChIKey | OOWWXXHBOQOXJZ-YHHAGCLASA-N |
| XLogP | 7.65 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.88 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|