C27H52O8Si — CID 56946987
1-[(2S,4R,6S)-6-[(E,4S,6S,8R)-6-[tert-butyl(dimethyl)silyl]oxy-4,8-bis(methoxymethoxy)non-1-enyl]-2-methyl-1,3-dioxan-4-yl]propan-2-one (PubChem CID 56946987) has the molecular formula C27H52O8Si and a molecular weight of 532.79 g/mol. Its IUPAC name is 1-[(2S,4R,6S)-6-[(E,4S,6S,8R)-6-[tert-butyl(dimethyl)silyl]oxy-4,8-bis(methoxymethoxy)non-1-enyl]-2-methyl-1,3-dioxan-4-yl]propan-2-one.
| Compound Name | 1-[(2S,4R,6S)-6-[(E,4S,6S,8R)-6-[tert-butyl(dimethyl)silyl]oxy-4,8-bis(methoxymethoxy)non-1-enyl]-2-methyl-1,3-dioxan-4-yl]propan-2-one |
|---|---|
| PubChem CID | 56946987 |
| Molecular Formula | C27H52O8Si |
| Molecular Weight | 532.79 g/mol |
| Exact Mass | 532.34 |
| IUPAC Name | 1-[(2S,4R,6S)-6-[(E,4S,6S,8R)-6-[tert-butyl(dimethyl)silyl]oxy-4,8-bis(methoxymethoxy)non-1-enyl]-2-methyl-1,3-dioxan-4-yl]propan-2-one |
| SMILES | COCO[C@@H](C/C=C/[C@@H]1C[C@H](CC(C)=O)O[C@H](C)O1)C[C@H](C[C@@H](C)OCOC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H52O8Si/c1-20(28)14-25-17-24(33-22(3)34-25)13-11-12-23(32-19-30-8)16-26(15-21(2)31-18-29-7)35-36(9,10)27(4,5)6/h11,13,21-26H,12,14-19H2,1-10H3/b13-11+/t21-,22-,23+,24-,25+,26+/m1/s1 |
| InChIKey | WEUDJIHCORYWIX-CNINBBRCSA-N |
| XLogP | 5.60 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.79 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|