C24H44O4Si — CID 134922655
2-[(4S,5S,6R)-6-[(1E,5E)-4-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethylhepta-1,5-dienyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]acetaldehyde (PubChem CID 134922655) has the molecular formula C24H44O4Si and a molecular weight of 424.70 g/mol. Its IUPAC name is 2-[(4S,5S,6R)-6-[(1E,5E)-4-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethylhepta-1,5-dienyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]acetaldehyde.
| Compound Name | 2-[(4S,5S,6R)-6-[(1E,5E)-4-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethylhepta-1,5-dienyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]acetaldehyde |
|---|---|
| PubChem CID | 134922655 |
| Molecular Formula | C24H44O4Si |
| Molecular Weight | 424.70 g/mol |
| Exact Mass | 424.30 |
| IUPAC Name | 2-[(4S,5S,6R)-6-[(1E,5E)-4-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethylhepta-1,5-dienyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]acetaldehyde |
| SMILES | C/C=C(\C)C(O[Si](C)(C)C(C)(C)C)C(C)/C=C/[C@H]1OC(C)(C)O[C@@H](CC=O)[C@@H]1C |
| InChI | InChI=1S/C24H44O4Si/c1-12-17(2)22(28-29(10,11)23(5,6)7)18(3)13-14-20-19(4)21(15-16-25)27-24(8,9)26-20/h12-14,16,18-22H,15H2,1-11H3/b14-13+,17-12+/t18?,19-,20-,21+,22?/m1/s1 |
| InChIKey | PNCRFMJQEOZTDI-SFGYKHBXSA-N |
| XLogP | 6.28 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.70 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|