C19H34O5Si — CID 10595367
(2R)-2-[(4S,6R,9R)-9-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-1,3,7-trioxaspiro[5.5]undec-10-en-4-yl]propanal (PubChem CID 10595367) has the molecular formula C19H34O5Si and a molecular weight of 370.56 g/mol. Its IUPAC name is (2R)-2-[(4S,6R,9R)-9-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-1,3,7-trioxaspiro[5.5]undec-10-en-4-yl]propanal.
| Compound Name | (2R)-2-[(4S,6R,9R)-9-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-1,3,7-trioxaspiro[5.5]undec-10-en-4-yl]propanal |
|---|---|
| PubChem CID | 10595367 |
| Molecular Formula | C19H34O5Si |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | (2R)-2-[(4S,6R,9R)-9-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-1,3,7-trioxaspiro[5.5]undec-10-en-4-yl]propanal |
| SMILES | C[C@@H](C=O)[C@@H]1C[C@]2(C=C[C@@H](O[Si](C)(C)C(C)(C)C)CO2)OC(C)(C)O1 |
| InChI | InChI=1S/C19H34O5Si/c1-14(12-20)16-11-19(24-18(5,6)22-16)10-9-15(13-21-19)23-25(7,8)17(2,3)4/h9-10,12,14-16H,11,13H2,1-8H3/t14-,15+,16-,19-/m0/s1 |
| InChIKey | QPEFVXWJLLAXLM-RCJHGTSTSA-N |
| XLogP | 4.04 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|