C21H40O4Si — CID 102299685
(E,2S,3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-8-(oxan-2-yloxy)oct-6-enal (PubChem CID 102299685) has the molecular formula C21H40O4Si and a molecular weight of 384.63 g/mol. Its IUPAC name is (E,2S,3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-8-(oxan-2-yloxy)oct-6-enal.
| Compound Name | (E,2S,3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-8-(oxan-2-yloxy)oct-6-enal |
|---|---|
| PubChem CID | 102299685 |
| Molecular Formula | C21H40O4Si |
| Molecular Weight | 384.63 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | (E,2S,3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-8-(oxan-2-yloxy)oct-6-enal |
| SMILES | C[C@H](C=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C/C=C/COC1CCCCO1 |
| InChI | InChI=1S/C21H40O4Si/c1-17(12-8-10-14-23-19-13-9-11-15-24-19)20(18(2)16-22)25-26(6,7)21(3,4)5/h8,10,16-20H,9,11-15H2,1-7H3/b10-8+/t17-,18-,19?,20-/m1/s1 |
| InChIKey | SRPAPYZROLAWAY-OACPFQFESA-N |
| XLogP | 5.34 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.63 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|