C38H74O5Si2 — CID 10974388
(E,3S,6R)-6-[(4S,6R)-6-[(E,5R)-5-[tert-butyl(dimethyl)silyl]oxydec-2-en-2-yl]-2,2,5,5-tetramethyl-1,3-dioxan-4-yl]-4-methyl-3-triethylsilyloxyhept-4-enal (PubChem CID 10974388) has the molecular formula C38H74O5Si2 and a molecular weight of 667.18 g/mol. Its IUPAC name is (E,3S,6R)-6-[(4S,6R)-6-[(E,5R)-5-[tert-butyl(dimethyl)silyl]oxydec-2-en-2-yl]-2,2,5,5-tetramethyl-1,3-dioxan-4-yl]-4-methyl-3-triethylsilyloxyhept-4-enal.
| Compound Name | (E,3S,6R)-6-[(4S,6R)-6-[(E,5R)-5-[tert-butyl(dimethyl)silyl]oxydec-2-en-2-yl]-2,2,5,5-tetramethyl-1,3-dioxan-4-yl]-4-methyl-3-triethylsilyloxyhept-4-enal |
|---|---|
| PubChem CID | 10974388 |
| Molecular Formula | C38H74O5Si2 |
| Molecular Weight | 667.18 g/mol |
| Exact Mass | 666.51 |
| IUPAC Name | (E,3S,6R)-6-[(4S,6R)-6-[(E,5R)-5-[tert-butyl(dimethyl)silyl]oxydec-2-en-2-yl]-2,2,5,5-tetramethyl-1,3-dioxan-4-yl]-4-methyl-3-triethylsilyloxyhept-4-enal |
| SMILES | CCCCC[C@H](C/C=C(\C)[C@H]1OC(C)(C)O[C@@H]([C@H](C)/C=C(\C)[C@H](CC=O)O[Si](CC)(CC)CC)C1(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C38H74O5Si2/c1-17-21-22-23-32(42-44(15,16)36(8,9)10)25-24-29(5)34-37(11,12)35(41-38(13,14)40-34)31(7)28-30(6)33(26-27-39)43-45(18-2,19-3)20-4/h24,27-28,31-35H,17-23,25-26H2,1-16H3/b29-24+,30-28+/t31-,32-,33+,34-,35+/m1/s1 |
| InChIKey | HYHJBJCSJIJKTM-SOAGQORYSA-N |
| XLogP | 11.40 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.18 |
| LogP ≤ 5 | 11.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|