C22H46O4Si2 — CID 11258971
(E,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyl-5-(2-trimethylsilylethoxymethoxy)oct-6-enal (PubChem CID 11258971) has the molecular formula C22H46O4Si2 and a molecular weight of 430.78 g/mol. Its IUPAC name is (E,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyl-5-(2-trimethylsilylethoxymethoxy)oct-6-enal.
| Compound Name | (E,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyl-5-(2-trimethylsilylethoxymethoxy)oct-6-enal |
|---|---|
| PubChem CID | 11258971 |
| Molecular Formula | C22H46O4Si2 |
| Molecular Weight | 430.78 g/mol |
| Exact Mass | 430.29 |
| IUPAC Name | (E,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyl-5-(2-trimethylsilylethoxymethoxy)oct-6-enal |
| SMILES | C/C=C/[C@H](OCOCC[Si](C)(C)C)C(C)(C)[C@H](CC=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H46O4Si2/c1-12-13-19(25-18-24-16-17-27(7,8)9)22(5,6)20(14-15-23)26-28(10,11)21(2,3)4/h12-13,15,19-20H,14,16-18H2,1-11H3/b13-12+/t19-,20-/m0/s1 |
| InChIKey | IQZLTEJXWNFCHG-DSJWGCTQSA-N |
| XLogP | 6.27 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.78 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|