C26H50O5Si — CID 11518445
(3S,5S)-5-[(3R)-4,4-dimethyl-5-tri(propan-2-yl)silyloxypent-1-en-3-yl]oxy-3-(methoxymethoxy)oct-7-enal (PubChem CID 11518445) has the molecular formula C26H50O5Si and a molecular weight of 470.77 g/mol. Its IUPAC name is (3S,5S)-5-[(3R)-4,4-dimethyl-5-tri(propan-2-yl)silyloxypent-1-en-3-yl]oxy-3-(methoxymethoxy)oct-7-enal.
| Compound Name | (3S,5S)-5-[(3R)-4,4-dimethyl-5-tri(propan-2-yl)silyloxypent-1-en-3-yl]oxy-3-(methoxymethoxy)oct-7-enal |
|---|---|
| PubChem CID | 11518445 |
| Molecular Formula | C26H50O5Si |
| Molecular Weight | 470.77 g/mol |
| Exact Mass | 470.34 |
| IUPAC Name | (3S,5S)-5-[(3R)-4,4-dimethyl-5-tri(propan-2-yl)silyloxypent-1-en-3-yl]oxy-3-(methoxymethoxy)oct-7-enal |
| SMILES | C=CC[C@@H](C[C@@H](CC=O)OCOC)O[C@H](C=C)C(C)(C)CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C26H50O5Si/c1-12-14-24(17-23(15-16-27)29-19-28-11)31-25(13-2)26(9,10)18-30-32(20(3)4,21(5)6)22(7)8/h12-13,16,20-25H,1-2,14-15,17-19H2,3-11H3/t23-,24+,25-/m1/s1 |
| InChIKey | WYBDFRNRXCUXRU-DSNGMDLFSA-N |
| XLogP | 6.69 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.77 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|